About (2S)-2-(formamidomethyl)-N'-methylpentanediamide
(2S)-2-(formamidomethyl)-N'-methylpentanediamide (PubChem CID 170579266) has the molecular formula C8H15N3O3
and a molecular weight of 201.23 g/mol. Its IUPAC name is (2S)-2-(formamidomethyl)-N'-methylpentanediamide.
Molecular Properties
| Compound Name | (2S)-2-(formamidomethyl)-N'-methylpentanediamide |
| PubChem CID | 170579266 |
| Molecular Formula | C8H15N3O3 |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.11 |
| IUPAC Name | (2S)-2-(formamidomethyl)-N'-methylpentanediamide |
| SMILES | CNC(=O)CC[C@@H](CNC=O)C(N)=O |
| InChI | InChI=1S/C8H15N3O3/c1-10-7(13)3-2-6(8(9)14)4-11-5-12/h5-6H,2-4H2,1H3,(H2,9,14)(H,10,13)(H,11,12)/t6-/m0/s1 |
| InChIKey | PXSWNWTVYMDUAR-LURJTMIESA-N |
| XLogP | -1.64 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-(formamidomethyl)-N'-methylpentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-(formamidomethyl)-N'-methylpentanediamide?
The IUPAC name of (2S)-2-(formamidomethyl)-N'-methylpentanediamide (CID 170579266) is (2S)-2-(formamidomethyl)-N'-methylpentanediamide.
What is the SMILES notation for (2S)-2-(formamidomethyl)-N'-methylpentanediamide?
The canonical SMILES for (2S)-2-(formamidomethyl)-N'-methylpentanediamide is CNC(=O)CC[C@@H](CNC=O)C(N)=O.
What is the InChIKey of (2S)-2-(formamidomethyl)-N'-methylpentanediamide?
The InChIKey is PXSWNWTVYMDUAR-LURJTMIESA-N. The full InChI is InChI=1S/C8H15N3O3/c1-10-7(13)3-2-6(8(9)14)4-11-5-12/h5-6H,2-4H2,1H3,(H2,9,14)(H,10,13)(H,11,12)/t6-/m0/s1.
What are the key properties of (2S)-2-(formamidomethyl)-N'-methylpentanediamide?
(2S)-2-(formamidomethyl)-N'-methylpentanediamide has a molecular weight of 201.23 g/mol, XLogP of -1.64, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(formamidomethyl)-N'-methylpentanediamide is sourced from PubChem (CID 170579266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).