About ethane;2-propan-2-yl-3,4-dihydropyridine
ethane;2-propan-2-yl-3,4-dihydropyridine (PubChem CID 170579308) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is ethane;2-propan-2-yl-3,4-dihydropyridine.
Molecular Properties
| Compound Name | ethane;2-propan-2-yl-3,4-dihydropyridine |
| PubChem CID | 170579308 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | ethane;2-propan-2-yl-3,4-dihydropyridine |
| SMILES | CC.CC(C)C1=NC=CCC1 |
| InChI | InChI=1S/C8H13N.C2H6/c1-7(2)8-5-3-4-6-9-8;1-2/h4,6-7H,3,5H2,1-2H3;1-2H3 |
| InChIKey | IPGGPIUDMPRXJF-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-propan-2-yl-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-propan-2-yl-3,4-dihydropyridine?
The IUPAC name of ethane;2-propan-2-yl-3,4-dihydropyridine (CID 170579308) is ethane;2-propan-2-yl-3,4-dihydropyridine.
What is the SMILES notation for ethane;2-propan-2-yl-3,4-dihydropyridine?
The canonical SMILES for ethane;2-propan-2-yl-3,4-dihydropyridine is CC.CC(C)C1=NC=CCC1.
What is the InChIKey of ethane;2-propan-2-yl-3,4-dihydropyridine?
The InChIKey is IPGGPIUDMPRXJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N.C2H6/c1-7(2)8-5-3-4-6-9-8;1-2/h4,6-7H,3,5H2,1-2H3;1-2H3.
What are the key properties of ethane;2-propan-2-yl-3,4-dihydropyridine?
ethane;2-propan-2-yl-3,4-dihydropyridine has a molecular weight of 153.27 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-propan-2-yl-3,4-dihydropyridine is sourced from PubChem (CID 170579308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).