About 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile
2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile (PubChem CID 170579615) has the molecular formula C17H13ClN4O
and a molecular weight of 324.77 g/mol. Its IUPAC name is 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile |
| PubChem CID | 170579615 |
| Molecular Formula | C17H13ClN4O |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2[nH]c(NC3CCOc4cc(Cl)ccc43)nc12 |
| InChI | InChI=1S/C17H13ClN4O/c18-11-4-5-12-13(6-7-23-15(12)8-11)20-17-21-14-3-1-2-10(9-19)16(14)22-17/h1-5,8,13H,6-7H2,(H2,20,21,22) |
| InChIKey | XPVAJMCABVGDQX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile?
The IUPAC name of 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile (CID 170579615) is 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile.
What is the SMILES notation for 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile?
The canonical SMILES for 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile is N#Cc1cccc2[nH]c(NC3CCOc4cc(Cl)ccc43)nc12.
What is the InChIKey of 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile?
The InChIKey is XPVAJMCABVGDQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClN4O/c18-11-4-5-12-13(6-7-23-15(12)8-11)20-17-21-14-3-1-2-10(9-19)16(14)22-17/h1-5,8,13H,6-7H2,(H2,20,21,22).
What are the key properties of 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile?
2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile has a molecular weight of 324.77 g/mol, XLogP of 4.02, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-chloro-3,4-dihydro-2H-chromen-4-yl)amino]-1H-benzimidazole-4-carbonitrile is sourced from PubChem (CID 170579615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).