About (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine
(S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine (PubChem CID 170579717) has the molecular formula C14H19Cl2NO
and a molecular weight of 288.22 g/mol. Its IUPAC name is (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine.
Molecular Properties
| Compound Name | (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine |
| PubChem CID | 170579717 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine |
| SMILES | Cc1ccc(Cl)c(Cl)c1[C@@H](N)C1(C)CCOCC1 |
| InChI | InChI=1S/C14H19Cl2NO/c1-9-3-4-10(15)12(16)11(9)13(17)14(2)5-7-18-8-6-14/h3-4,13H,5-8,17H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZKYMPXZDTZGPNF-CYBMUJFWSA-N |
| XLogP | 4.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine?
The IUPAC name of (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine (CID 170579717) is (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine.
What is the SMILES notation for (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine?
The canonical SMILES for (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine is Cc1ccc(Cl)c(Cl)c1[C@@H](N)C1(C)CCOCC1.
What is the InChIKey of (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine?
The InChIKey is ZKYMPXZDTZGPNF-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H19Cl2NO/c1-9-3-4-10(15)12(16)11(9)13(17)14(2)5-7-18-8-6-14/h3-4,13H,5-8,17H2,1-2H3/t13-/m1/s1.
What are the key properties of (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine?
(S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine has a molecular weight of 288.22 g/mol, XLogP of 4.12, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (S)-(2,3-dichloro-6-methylphenyl)-(4-methyloxan-4-yl)methanamine is sourced from PubChem (CID 170579717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).