About 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile
2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile (PubChem CID 170579935) has the molecular formula C20H18F2N4
and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile.
Molecular Properties
| Compound Name | 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile |
| PubChem CID | 170579935 |
| Molecular Formula | C20H18F2N4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile |
| SMILES | N#Cc1cccc2[nH]c(N[C@@H](c3ccc(F)cc3F)C3CCCC3)nc12 |
| InChI | InChI=1S/C20H18F2N4/c21-14-8-9-15(16(22)10-14)18(12-4-1-2-5-12)25-20-24-17-7-3-6-13(11-23)19(17)26-20/h3,6-10,12,18H,1-2,4-5H2,(H2,24,25,26)/t18-/m1/s1 |
| InChIKey | UGXGFHVYUAIOAY-GOSISDBHSA-N |
| XLogP | 5.06 |
| TPSA | 64.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile?
The IUPAC name of 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile (CID 170579935) is 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile.
What is the SMILES notation for 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile?
The canonical SMILES for 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile is N#Cc1cccc2[nH]c(N[C@@H](c3ccc(F)cc3F)C3CCCC3)nc12.
What is the InChIKey of 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile?
The InChIKey is UGXGFHVYUAIOAY-GOSISDBHSA-N. The full InChI is InChI=1S/C20H18F2N4/c21-14-8-9-15(16(22)10-14)18(12-4-1-2-5-12)25-20-24-17-7-3-6-13(11-23)19(17)26-20/h3,6-10,12,18H,1-2,4-5H2,(H2,24,25,26)/t18-/m1/s1.
What are the key properties of 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile?
2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile has a molecular weight of 352.39 g/mol, XLogP of 5.06, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(R)-cyclopentyl-(2,4-difluorophenyl)methyl]amino]-1H-benzimidazole-4-carbonitrile is sourced from PubChem (CID 170579935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).