C20H31N3O2 — CID 170580136
1-(1-acetylpiperidin-4-yl)-3-[(2E,3Z)-1-cyclobutyl-2-ethylidenehexa-3,5-dienyl]urea (PubChem CID 170580136) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-(1-acetylpiperidin-4-yl)-3-[(2E,3Z)-1-cyclobutyl-2-ethylidenehexa-3,5-dienyl]urea.
| Compound Name | 1-(1-acetylpiperidin-4-yl)-3-[(2E,3Z)-1-cyclobutyl-2-ethylidenehexa-3,5-dienyl]urea |
|---|---|
| PubChem CID | 170580136 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | 1-(1-acetylpiperidin-4-yl)-3-[(2E,3Z)-1-cyclobutyl-2-ethylidenehexa-3,5-dienyl]urea |
| SMILES | C=C/C=C\C(=C/C)C(NC(=O)NC1CCN(C(C)=O)CC1)C1CCC1 |
| InChI | InChI=1S/C20H31N3O2/c1-4-6-8-16(5-2)19(17-9-7-10-17)22-20(25)21-18-11-13-23(14-12-18)15(3)24/h4-6,8,17-19H,1,7,9-14H2,2-3H3,(H2,21,22,25)/b8-6-,16-5+ |
| InChIKey | HXEFNHXIBXQNLR-LKJHDKRSSA-N |
| XLogP | 3.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|