C25H34Cl2F2N2O2 — CID 170580371
N-[(2,3-dichloro-6-fluoro-5-hydroxyphenyl)-(4-fluoro-1-bicyclo[2.2.1]heptanyl)methyl]cyclopentanecarboxamide;N,2-dimethylprop-2-en-1-amine (PubChem CID 170580371) has the molecular formula C25H34Cl2F2N2O2 and a molecular weight of 503.46 g/mol. Its IUPAC name is N-[(2,3-dichloro-6-fluoro-5-hydroxyphenyl)-(4-fluoro-1-bicyclo[2.2.1]heptanyl)methyl]cyclopentanecarboxamide;N,2-dimethylprop-2-en-1-amine.
| Compound Name | N-[(2,3-dichloro-6-fluoro-5-hydroxyphenyl)-(4-fluoro-1-bicyclo[2.2.1]heptanyl)methyl]cyclopentanecarboxamide;N,2-dimethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 170580371 |
| Molecular Formula | C25H34Cl2F2N2O2 |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | N-[(2,3-dichloro-6-fluoro-5-hydroxyphenyl)-(4-fluoro-1-bicyclo[2.2.1]heptanyl)methyl]cyclopentanecarboxamide;N,2-dimethylprop-2-en-1-amine |
| SMILES | C=C(C)CNC.O=C(NC(c1c(F)c(O)cc(Cl)c1Cl)C12CCC(F)(CC1)C2)C1CCCC1 |
| InChI | InChI=1S/C20H23Cl2F2NO2.C5H11N/c21-12-9-13(26)16(23)14(15(12)22)17(25-18(27)11-3-1-2-4-11)19-5-7-20(24,10-19)8-6-19;1-5(2)4-6-3/h9,11,17,26H,1-8,10H2,(H,25,27);6H,1,4H2,2-3H3 |
| InChIKey | HMWTZOMOZWWCIL-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|