About acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide
acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide (PubChem CID 170580687) has the molecular formula C20H27ClF2N2O2
and a molecular weight of 400.90 g/mol. Its IUPAC name is acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide |
| PubChem CID | 170580687 |
| Molecular Formula | C20H27ClF2N2O2 |
| Molecular Weight | 400.90 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide |
| SMILES | CC(N)=O.O=C(NC(c1c(F)ccc(Cl)c1F)C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C18H22ClF2NO.C2H5NO/c19-13-9-10-14(20)15(16(13)21)17(11-5-1-2-6-11)22-18(23)12-7-3-4-8-12;1-2(3)4/h9-12,17H,1-8H2,(H,22,23);1H3,(H2,3,4) |
| InChIKey | BGSKSXMCGHKFEA-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.90 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide?
The IUPAC name of acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide (CID 170580687) is acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide.
What is the SMILES notation for acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide?
The canonical SMILES for acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide is CC(N)=O.O=C(NC(c1c(F)ccc(Cl)c1F)C1CCCC1)C1CCCC1.
What is the InChIKey of acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide?
The InChIKey is BGSKSXMCGHKFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22ClF2NO.C2H5NO/c19-13-9-10-14(20)15(16(13)21)17(11-5-1-2-6-11)22-18(23)12-7-3-4-8-12;1-2(3)4/h9-12,17H,1-8H2,(H,22,23);1H3,(H2,3,4).
What are the key properties of acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide?
acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide has a molecular weight of 400.90 g/mol, XLogP of 4.65, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;N-[(3-chloro-2,6-difluorophenyl)-cyclopentylmethyl]cyclopentanecarboxamide is sourced from PubChem (CID 170580687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).