C8H7ClN2S — CID 170581705
6-chloro-3,5-dimethylthieno[2,3-c]pyridazine (PubChem CID 170581705) has the molecular formula C8H7ClN2S and a molecular weight of 198.68 g/mol. Its IUPAC name is 6-chloro-3,5-dimethylthieno[2,3-c]pyridazine.
| Compound Name | 6-chloro-3,5-dimethylthieno[2,3-c]pyridazine |
|---|---|
| PubChem CID | 170581705 |
| Molecular Formula | C8H7ClN2S |
| Molecular Weight | 198.68 g/mol |
| Exact Mass | 198.00 |
| IUPAC Name | 6-chloro-3,5-dimethylthieno[2,3-c]pyridazine |
| SMILES | Cc1cc2c(C)c(Cl)sc2nn1 |
| InChI | InChI=1S/C8H7ClN2S/c1-4-3-6-5(2)7(9)12-8(6)11-10-4/h3H,1-2H3 |
| InChIKey | JLQBYCSPTMTENF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.68 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |