C13H23F2N3 — CID 170581770
1-(3,3-difluoro-1-methylpiperidin-4-yl)-4-prop-2-enylpiperazine (PubChem CID 170581770) has the molecular formula C13H23F2N3 and a molecular weight of 259.34 g/mol. Its IUPAC name is 1-(3,3-difluoro-1-methylpiperidin-4-yl)-4-prop-2-enylpiperazine.
| Compound Name | 1-(3,3-difluoro-1-methylpiperidin-4-yl)-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 170581770 |
| Molecular Formula | C13H23F2N3 |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-(3,3-difluoro-1-methylpiperidin-4-yl)-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN(C2CCN(C)CC2(F)F)CC1 |
| InChI | InChI=1S/C13H23F2N3/c1-3-5-17-7-9-18(10-8-17)12-4-6-16(2)11-13(12,14)15/h3,12H,1,4-11H2,2H3 |
| InChIKey | SOPHMGBNYFAVCS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|