C10H8N2O3S2 — CID 170582475
4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 170582475) has the molecular formula C10H8N2O3S2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid.
| Compound Name | 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 170582475 |
| Molecular Formula | C10H8N2O3S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CC1(c2nc(-c3cscn3)sc2C(=O)O)CO1 |
| InChI | InChI=1S/C10H8N2O3S2/c1-10(3-15-10)7-6(9(13)14)17-8(12-7)5-2-16-4-11-5/h2,4H,3H2,1H3,(H,13,14) |
| InChIKey | DYYZOWZYQGBEME-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|