About 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid
4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid (PubChem CID 170582475) has the molecular formula C10H8N2O3S2
and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 170582475 |
| Molecular Formula | C10H8N2O3S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid |
| SMILES | CC1(c2nc(-c3cscn3)sc2C(=O)O)CO1 |
| InChI | InChI=1S/C10H8N2O3S2/c1-10(3-15-10)7-6(9(13)14)17-8(12-7)5-2-16-4-11-5/h2,4H,3H2,1H3,(H,13,14) |
| InChIKey | DYYZOWZYQGBEME-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid (CID 170582475) is 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid is CC1(c2nc(-c3cscn3)sc2C(=O)O)CO1.
What is the InChIKey of 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is DYYZOWZYQGBEME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3S2/c1-10(3-15-10)7-6(9(13)14)17-8(12-7)5-2-16-4-11-5/h2,4H,3H2,1H3,(H,13,14).
What are the key properties of 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid?
4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 268.32 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methyloxiran-2-yl)-2-(1,3-thiazol-4-yl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 170582475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).