About ethane;4-methylpyrrolidin-2-one;oxane
ethane;4-methylpyrrolidin-2-one;oxane (PubChem CID 170582755) has the molecular formula C12H25NO2
and a molecular weight of 215.34 g/mol. Its IUPAC name is ethane;4-methylpyrrolidin-2-one;oxane.
Molecular Properties
| Compound Name | ethane;4-methylpyrrolidin-2-one;oxane |
| PubChem CID | 170582755 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | ethane;4-methylpyrrolidin-2-one;oxane |
| SMILES | C1CCOCC1.CC.CC1CNC(=O)C1 |
| InChI | InChI=1S/C5H9NO.C5H10O.C2H6/c1-4-2-5(7)6-3-4;1-2-4-6-5-3-1;1-2/h4H,2-3H2,1H3,(H,6,7);1-5H2;1-2H3 |
| InChIKey | NFERHJJYNDCQQN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methylpyrrolidin-2-one;oxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methylpyrrolidin-2-one;oxane?
The IUPAC name of ethane;4-methylpyrrolidin-2-one;oxane (CID 170582755) is ethane;4-methylpyrrolidin-2-one;oxane.
What is the SMILES notation for ethane;4-methylpyrrolidin-2-one;oxane?
The canonical SMILES for ethane;4-methylpyrrolidin-2-one;oxane is C1CCOCC1.CC.CC1CNC(=O)C1.
What is the InChIKey of ethane;4-methylpyrrolidin-2-one;oxane?
The InChIKey is NFERHJJYNDCQQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO.C5H10O.C2H6/c1-4-2-5(7)6-3-4;1-2-4-6-5-3-1;1-2/h4H,2-3H2,1H3,(H,6,7);1-5H2;1-2H3.
What are the key properties of ethane;4-methylpyrrolidin-2-one;oxane?
ethane;4-methylpyrrolidin-2-one;oxane has a molecular weight of 215.34 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methylpyrrolidin-2-one;oxane is sourced from PubChem (CID 170582755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).