C10H15ClN2O — CID 170583054
N-[(1Z,3Z)-1-chloro-1-(methylideneamino)penta-1,3-dien-2-yl]butanamide (PubChem CID 170583054) has the molecular formula C10H15ClN2O and a molecular weight of 214.70 g/mol. Its IUPAC name is N-[(1Z,3Z)-1-chloro-1-(methylideneamino)penta-1,3-dien-2-yl]butanamide.
| Compound Name | N-[(1Z,3Z)-1-chloro-1-(methylideneamino)penta-1,3-dien-2-yl]butanamide |
|---|---|
| PubChem CID | 170583054 |
| Molecular Formula | C10H15ClN2O |
| Molecular Weight | 214.70 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | N-[(1Z,3Z)-1-chloro-1-(methylideneamino)penta-1,3-dien-2-yl]butanamide |
| SMILES | C=N/C(Cl)=C(\C=C/C)NC(=O)CCC |
| InChI | InChI=1S/C10H15ClN2O/c1-4-6-8(10(11)12-3)13-9(14)7-5-2/h4,6H,3,5,7H2,1-2H3,(H,13,14)/b6-4-,10-8+ |
| InChIKey | PTBGTDDGTDDJHB-YUFRWXHNSA-N |
| XLogP | 2.59 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.70 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|