About N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen
N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen (PubChem CID 170583064) has the molecular formula C9H17N3O2
and a molecular weight of 199.25 g/mol. Its IUPAC name is N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen.
Molecular Properties
| Compound Name | N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen |
| PubChem CID | 170583064 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen |
| SMILES | CCCCC(=O)NCc1noc(C)n1.[H][H] |
| InChI | InChI=1S/C9H15N3O2.H2/c1-3-4-5-9(13)10-6-8-11-7(2)14-12-8;/h3-6H2,1-2H3,(H,10,13);1H |
| InChIKey | GVOXFEWCZHNQNA-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen?
The IUPAC name of N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen (CID 170583064) is N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen.
What is the SMILES notation for N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen?
The canonical SMILES for N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen is CCCCC(=O)NCc1noc(C)n1.[H][H].
What is the InChIKey of N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen?
The InChIKey is GVOXFEWCZHNQNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2.H2/c1-3-4-5-9(13)10-6-8-11-7(2)14-12-8;/h3-6H2,1-2H3,(H,10,13);1H.
What are the key properties of N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen?
N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen has a molecular weight of 199.25 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]pentanamide;molecular hydrogen is sourced from PubChem (CID 170583064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).