C29H29ClF2N6O — CID 170583554
4-[5-chloro-4-(3-ethyl-5-propylpiperazin-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-amine (PubChem CID 170583554) has the molecular formula C29H29ClF2N6O and a molecular weight of 551.04 g/mol. Its IUPAC name is 4-[5-chloro-4-(3-ethyl-5-propylpiperazin-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-amine.
| Compound Name | 4-[5-chloro-4-(3-ethyl-5-propylpiperazin-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-amine |
|---|---|
| PubChem CID | 170583554 |
| Molecular Formula | C29H29ClF2N6O |
| Molecular Weight | 551.04 g/mol |
| Exact Mass | 550.21 |
| IUPAC Name | 4-[5-chloro-4-(3-ethyl-5-propylpiperazin-1-yl)-8-fluoro-2-methoxypyrido[4,3-d]pyrimidin-7-yl]-5-ethynyl-6-fluoronaphthalen-2-amine |
| SMILES | C#Cc1c(F)ccc2cc(N)cc(-c3nc(Cl)c4c(N5CC(CC)NC(CCC)C5)nc(OC)nc4c3F)c12 |
| InChI | InChI=1S/C29H29ClF2N6O/c1-5-8-18-14-38(13-17(6-2)34-18)28-23-26(36-29(37-28)39-4)24(32)25(35-27(23)30)20-12-16(33)11-15-9-10-21(31)19(7-3)22(15)20/h3,9-12,17-18,34H,5-6,8,13-14,33H2,1-2,4H3 |
| InChIKey | YIQBAQIYORJTBE-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.04 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|