About N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen
N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen (PubChem CID 170583765) has the molecular formula C10H25NO
and a molecular weight of 175.32 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen |
| PubChem CID | 170583765 |
| Molecular Formula | C10H25NO |
| Molecular Weight | 175.32 g/mol |
| Exact Mass | 175.19 |
| IUPAC Name | N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen |
| SMILES | CCC(NCCOC)C(C)(C)C.[H][H] |
| InChI | InChI=1S/C10H23NO.H2/c1-6-9(10(2,3)4)11-7-8-12-5;/h9,11H,6-8H2,1-5H3;1H |
| InChIKey | FYPMNHQGAMGPCR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen?
The IUPAC name of N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen (CID 170583765) is N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen.
What is the SMILES notation for N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen?
The canonical SMILES for N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen is CCC(NCCOC)C(C)(C)C.[H][H].
What is the InChIKey of N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen?
The InChIKey is FYPMNHQGAMGPCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO.H2/c1-6-9(10(2,3)4)11-7-8-12-5;/h9,11H,6-8H2,1-5H3;1H.
What are the key properties of N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen?
N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen has a molecular weight of 175.32 g/mol, XLogP of 2.29, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-2,2-dimethylpentan-3-amine;molecular hydrogen is sourced from PubChem (CID 170583765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).