About 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane
1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane (PubChem CID 170584933) has the molecular formula C8H17F4NO
and a molecular weight of 219.22 g/mol. Its IUPAC name is 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane.
Molecular Properties
| Compound Name | 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane |
| PubChem CID | 170584933 |
| Molecular Formula | C8H17F4NO |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane |
| SMILES | CC.CC(F)(F)OCC(N)C(C)(F)F |
| InChI | InChI=1S/C6H11F4NO.C2H6/c1-5(7,8)4(11)3-12-6(2,9)10;1-2/h4H,3,11H2,1-2H3;1-2H3 |
| InChIKey | LDYOSMZMOLZVNN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane?
The IUPAC name of 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane (CID 170584933) is 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane.
What is the SMILES notation for 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane?
The canonical SMILES for 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane is CC.CC(F)(F)OCC(N)C(C)(F)F.
What is the InChIKey of 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane?
The InChIKey is LDYOSMZMOLZVNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F4NO.C2H6/c1-5(7,8)4(11)3-12-6(2,9)10;1-2/h4H,3,11H2,1-2H3;1-2H3.
What are the key properties of 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane?
1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane has a molecular weight of 219.22 g/mol, XLogP of 2.62, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,1-difluoroethoxy)-3,3-difluorobutan-2-amine;ethane is sourced from PubChem (CID 170584933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).