About [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate
[(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate (PubChem CID 170585176) has the molecular formula C22H26O4
and a molecular weight of 354.45 g/mol. Its IUPAC name is [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate |
| PubChem CID | 170585176 |
| Molecular Formula | C22H26O4 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(COC[C@H]2O[C@H](C)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H26O4/c1-15-4-8-18(9-5-15)13-24-14-21-20(12-17(3)25-21)26-22(23)19-10-6-16(2)7-11-19/h4-11,17,20-21H,12-14H2,1-3H3/t17-,20+,21-/m1/s1 |
| InChIKey | WVBWOFWNROJGFD-JRGCBEDISA-N |
| XLogP | 4.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate?
The IUPAC name of [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate (CID 170585176) is [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate.
What is the SMILES notation for [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate?
The canonical SMILES for [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate is Cc1ccc(COC[C@H]2O[C@H](C)C[C@@H]2OC(=O)c2ccc(C)cc2)cc1.
What is the InChIKey of [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate?
The InChIKey is WVBWOFWNROJGFD-JRGCBEDISA-N. The full InChI is InChI=1S/C22H26O4/c1-15-4-8-18(9-5-15)13-24-14-21-20(12-17(3)25-21)26-22(23)19-10-6-16(2)7-11-19/h4-11,17,20-21H,12-14H2,1-3H3/t17-,20+,21-/m1/s1.
What are the key properties of [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate?
[(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate has a molecular weight of 354.45 g/mol, XLogP of 4.22, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3S,5R)-5-methyl-2-[(4-methylphenyl)methoxymethyl]oxolan-3-yl] 4-methylbenzoate is sourced from PubChem (CID 170585176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).