About 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane
2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane (PubChem CID 170585214) has the molecular formula C7H11N5O2
and a molecular weight of 197.20 g/mol. Its IUPAC name is 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane.
Molecular Properties
| Compound Name | 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane |
| PubChem CID | 170585214 |
| Molecular Formula | C7H11N5O2 |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane |
| SMILES | CC.Nc1nc2[nH]c(=O)[nH]c2c(=O)[nH]1 |
| InChI | InChI=1S/C5H5N5O2.C2H6/c6-4-8-2-1(3(11)10-4)7-5(12)9-2;1-2/h(H5,6,7,8,9,10,11,12);1-2H3 |
| InChIKey | CBGWWKMYOUSVFQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 120.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane?
The IUPAC name of 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane (CID 170585214) is 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane.
What is the SMILES notation for 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane?
The canonical SMILES for 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane is CC.Nc1nc2[nH]c(=O)[nH]c2c(=O)[nH]1.
What is the InChIKey of 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane?
The InChIKey is CBGWWKMYOUSVFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O2.C2H6/c6-4-8-2-1(3(11)10-4)7-5(12)9-2;1-2/h(H5,6,7,8,9,10,11,12);1-2H3.
What are the key properties of 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane?
2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane has a molecular weight of 197.20 g/mol, XLogP of -0.45, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7,9-dihydro-1H-purine-6,8-dione;ethane is sourced from PubChem (CID 170585214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).