C34H24Br2O — CID 170585331
5,5-bis(4-bromophenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaene (PubChem CID 170585331) has the molecular formula C34H24Br2O and a molecular weight of 608.37 g/mol. Its IUPAC name is 5,5-bis(4-bromophenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaene.
| Compound Name | 5,5-bis(4-bromophenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaene |
|---|---|
| PubChem CID | 170585331 |
| Molecular Formula | C34H24Br2O |
| Molecular Weight | 608.37 g/mol |
| Exact Mass | 606.02 |
| IUPAC Name | 5,5-bis(4-bromophenyl)-21,21-dimethyl-6-oxapentacyclo[12.7.0.02,7.08,13.015,20]henicosa-1(14),2(7),3,8,10,12,15,17,19-nonaene |
| SMILES | CC1(C)c2ccccc2-c2c1c1c(c3ccccc23)OC(c2ccc(Br)cc2)(c2ccc(Br)cc2)C=C1 |
| InChI | InChI=1S/C34H24Br2O/c1-33(2)29-10-6-5-9-27(29)30-25-7-3-4-8-26(25)32-28(31(30)33)19-20-34(37-32,21-11-15-23(35)16-12-21)22-13-17-24(36)18-14-22/h3-20H,1-2H3 |
| InChIKey | XOBUHWATXMEXSS-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.37 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |