C14H22N2O2 — CID 170585614
formic acid;3-methyl-4-(1-methylpiperidin-4-yl)aniline (PubChem CID 170585614) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is formic acid;3-methyl-4-(1-methylpiperidin-4-yl)aniline.
| Compound Name | formic acid;3-methyl-4-(1-methylpiperidin-4-yl)aniline |
|---|---|
| PubChem CID | 170585614 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | formic acid;3-methyl-4-(1-methylpiperidin-4-yl)aniline |
| SMILES | Cc1cc(N)ccc1C1CCN(C)CC1.O=CO |
| InChI | InChI=1S/C13H20N2.CH2O2/c1-10-9-12(14)3-4-13(10)11-5-7-15(2)8-6-11;2-1-3/h3-4,9,11H,5-8,14H2,1-2H3;1H,(H,2,3) |
| InChIKey | UDTGBDRLWRNQFA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|