C23H24N6O4S — CID 170585746
7-(11-methyl-4,6-dioxa-2,8-diazatricyclo[5.4.0.03,5]undeca-1(11),7,9-trien-10-yl)-N-[4-(methylsulfonylmethyl)phenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine (PubChem CID 170585746) has the molecular formula C23H24N6O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is 7-(11-methyl-4,6-dioxa-2,8-diazatricyclo[5.4.0.03,5]undeca-1(11),7,9-trien-10-yl)-N-[4-(methylsulfonylmethyl)phenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | 7-(11-methyl-4,6-dioxa-2,8-diazatricyclo[5.4.0.03,5]undeca-1(11),7,9-trien-10-yl)-N-[4-(methylsulfonylmethyl)phenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170585746 |
| Molecular Formula | C23H24N6O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | 7-(11-methyl-4,6-dioxa-2,8-diazatricyclo[5.4.0.03,5]undeca-1(11),7,9-trien-10-yl)-N-[4-(methylsulfonylmethyl)phenyl]-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-2-amine |
| SMILES | Cc1c(N2CCc3cnc(Nc4ccc(CS(C)(=O)=O)cc4)nc3C2)cnc2c1NC1OC1O2 |
| InChI | InChI=1S/C23H24N6O4S/c1-13-18(10-24-20-19(13)28-21-22(32-20)33-21)29-8-7-15-9-25-23(27-17(15)11-29)26-16-5-3-14(4-6-16)12-34(2,30)31/h3-6,9-10,21-22,28H,7-8,11-12H2,1-2H3,(H,25,26,27) |
| InChIKey | DLTFTWVXQPMLGV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 121.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|