About benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate
benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate (PubChem CID 170585819) has the molecular formula C21H17NO6
and a molecular weight of 379.37 g/mol. Its IUPAC name is benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate.
Molecular Properties
| Compound Name | benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate |
| PubChem CID | 170585819 |
| Molecular Formula | C21H17NO6 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate |
| SMILES | O=C(CC1CC(N2C(=O)c3ccccc3C2=O)C(=O)O1)OCc1ccccc1 |
| InChI | InChI=1S/C21H17NO6/c23-18(27-12-13-6-2-1-3-7-13)11-14-10-17(21(26)28-14)22-19(24)15-8-4-5-9-16(15)20(22)25/h1-9,14,17H,10-12H2 |
| InChIKey | GRWFRIIHCNQPEZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate?
The IUPAC name of benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate (CID 170585819) is benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate.
What is the SMILES notation for benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate?
The canonical SMILES for benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate is O=C(CC1CC(N2C(=O)c3ccccc3C2=O)C(=O)O1)OCc1ccccc1.
What is the InChIKey of benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate?
The InChIKey is GRWFRIIHCNQPEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17NO6/c23-18(27-12-13-6-2-1-3-7-13)11-14-10-17(21(26)28-14)22-19(24)15-8-4-5-9-16(15)20(22)25/h1-9,14,17H,10-12H2.
What are the key properties of benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate?
benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate has a molecular weight of 379.37 g/mol, XLogP of 2.10, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[4-(1,3-dioxoisoindol-2-yl)-5-oxooxolan-2-yl]acetate is sourced from PubChem (CID 170585819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).