C40H48N8O3 — CID 170586650
7-cyclopentyl-2-[[5-[4-[4-[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]ethyl]cyclohexyl]piperazin-1-yl]-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carbaldehyde (PubChem CID 170586650) has the molecular formula C40H48N8O3 and a molecular weight of 688.88 g/mol. Its IUPAC name is 7-cyclopentyl-2-[[5-[4-[4-[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]ethyl]cyclohexyl]piperazin-1-yl]-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carbaldehyde.
| Compound Name | 7-cyclopentyl-2-[[5-[4-[4-[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]ethyl]cyclohexyl]piperazin-1-yl]-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
|---|---|
| PubChem CID | 170586650 |
| Molecular Formula | C40H48N8O3 |
| Molecular Weight | 688.88 g/mol |
| Exact Mass | 688.38 |
| IUPAC Name | 7-cyclopentyl-2-[[5-[4-[4-[2-[4-(2,6-dioxopiperidin-3-yl)phenyl]ethyl]cyclohexyl]piperazin-1-yl]-2-pyridinyl]amino]pyrrolo[2,3-d]pyrimidine-6-carbaldehyde |
| SMILES | O=Cc1cc2cnc(Nc3ccc(N4CCN(C5CCC(CCc6ccc(C7CCC(=O)NC7=O)cc6)CC5)CC4)cn3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C40H48N8O3/c49-26-34-23-30-24-42-40(45-38(30)48(34)32-3-1-2-4-32)43-36-17-15-33(25-41-36)47-21-19-46(20-22-47)31-13-9-28(10-14-31)6-5-27-7-11-29(12-8-27)35-16-18-37(50)44-39(35)51/h7-8,11-12,15,17,23-26,28,31-32,35H,1-6,9-10,13-14,16,18-22H2,(H,44,50,51)(H,41,42,43,45) |
| InChIKey | OWPQLPAYPPWVKJ-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 125.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.88 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|