C17H22N6O2 — CID 170586790
N-[3-(2H-tetrazol-5-yl)propyl]-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide (PubChem CID 170586790) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-[3-(2H-tetrazol-5-yl)propyl]-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide.
| Compound Name | N-[3-(2H-tetrazol-5-yl)propyl]-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide |
|---|---|
| PubChem CID | 170586790 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-[3-(2H-tetrazol-5-yl)propyl]-2-(3,3,5-trimethyl-2-oxoindol-1-yl)acetamide |
| SMILES | Cc1ccc2c(c1)C(C)(C)C(=O)N2CC(=O)NCCCc1nn[nH]n1 |
| InChI | InChI=1S/C17H22N6O2/c1-11-6-7-13-12(9-11)17(2,3)16(25)23(13)10-15(24)18-8-4-5-14-19-21-22-20-14/h6-7,9H,4-5,8,10H2,1-3H3,(H,18,24)(H,19,20,21,22) |
| InChIKey | GGDIMPFDWVIUJT-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 103.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|