C27H42F2N2O4 — CID 170586797
5-cyclopropyl-1-ethyl-4,7-difluoro-3,3-dimethylindol-2-one;ethane;ethyl 4-formamido-3,3-dimethylpentanoate (PubChem CID 170586797) has the molecular formula C27H42F2N2O4 and a molecular weight of 496.64 g/mol. Its IUPAC name is 5-cyclopropyl-1-ethyl-4,7-difluoro-3,3-dimethylindol-2-one;ethane;ethyl 4-formamido-3,3-dimethylpentanoate.
| Compound Name | 5-cyclopropyl-1-ethyl-4,7-difluoro-3,3-dimethylindol-2-one;ethane;ethyl 4-formamido-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 170586797 |
| Molecular Formula | C27H42F2N2O4 |
| Molecular Weight | 496.64 g/mol |
| Exact Mass | 496.31 |
| IUPAC Name | 5-cyclopropyl-1-ethyl-4,7-difluoro-3,3-dimethylindol-2-one;ethane;ethyl 4-formamido-3,3-dimethylpentanoate |
| SMILES | CC.CCN1C(=O)C(C)(C)c2c(F)c(C3CC3)cc(F)c21.CCOC(=O)CC(C)(C)C(C)NC=O |
| InChI | InChI=1S/C15H17F2NO.C10H19NO3.C2H6/c1-4-18-13-10(16)7-9(8-5-6-8)12(17)11(13)15(2,3)14(18)19;1-5-14-9(13)6-10(3,4)8(2)11-7-12;1-2/h7-8H,4-6H2,1-3H3;7-8H,5-6H2,1-4H3,(H,11,12);1-2H3 |
| InChIKey | OULZOEAKQSYCOV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.64 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|