C18H27NS — CID 170587640
2-tert-butyl-4-phenyl-5-propan-2-yl-1,3-thiazole;ethane (PubChem CID 170587640) has the molecular formula C18H27NS and a molecular weight of 289.49 g/mol. Its IUPAC name is 2-tert-butyl-4-phenyl-5-propan-2-yl-1,3-thiazole;ethane.
| Compound Name | 2-tert-butyl-4-phenyl-5-propan-2-yl-1,3-thiazole;ethane |
|---|---|
| PubChem CID | 170587640 |
| Molecular Formula | C18H27NS |
| Molecular Weight | 289.49 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | 2-tert-butyl-4-phenyl-5-propan-2-yl-1,3-thiazole;ethane |
| SMILES | CC.CC(C)c1sc(C(C)(C)C)nc1-c1ccccc1 |
| InChI | InChI=1S/C16H21NS.C2H6/c1-11(2)14-13(12-9-7-6-8-10-12)17-15(18-14)16(3,4)5;1-2/h6-11H,1-5H3;1-2H3 |
| InChIKey | ZSUBGLXWHPKFNB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.49 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |