About 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane
3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane (PubChem CID 170587698) has the molecular formula C23H42N2O2
and a molecular weight of 378.60 g/mol. Its IUPAC name is 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane.
Molecular Properties
| Compound Name | 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane |
| PubChem CID | 170587698 |
| Molecular Formula | C23H42N2O2 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.32 |
| IUPAC Name | 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane |
| SMILES | CC.CC.COc1cnc(CN2CCC3(CCCCC3)CC2)c(OC)c1C |
| InChI | InChI=1S/C19H30N2O2.2C2H6/c1-15-17(22-2)13-20-16(18(15)23-3)14-21-11-9-19(10-12-21)7-5-4-6-8-19;2*1-2/h13H,4-12,14H2,1-3H3;2*1-2H3 |
| InChIKey | ZUFCOUKQQCOVJP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane?
The IUPAC name of 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane (CID 170587698) is 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane.
What is the SMILES notation for 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane?
The canonical SMILES for 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane is CC.CC.COc1cnc(CN2CCC3(CCCCC3)CC2)c(OC)c1C.
What is the InChIKey of 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane?
The InChIKey is ZUFCOUKQQCOVJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30N2O2.2C2H6/c1-15-17(22-2)13-20-16(18(15)23-3)14-21-11-9-19(10-12-21)7-5-4-6-8-19;2*1-2/h13H,4-12,14H2,1-3H3;2*1-2H3.
What are the key properties of 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane?
3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane has a molecular weight of 378.60 g/mol, XLogP of 6.01, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,5-dimethoxy-4-methyl-2-pyridinyl)methyl]-3-azaspiro[5.5]undecane;ethane is sourced from PubChem (CID 170587698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).