About 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine
1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine (PubChem CID 170588431) has the molecular formula C19H27NO
and a molecular weight of 285.43 g/mol. Its IUPAC name is 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine.
Molecular Properties
| Compound Name | 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine |
| PubChem CID | 170588431 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine |
| SMILES | CCc1c(OC)cc(CN2CCCCC2)c2c1=CCCC=2 |
| InChI | InChI=1S/C19H27NO/c1-3-16-18-10-6-5-9-17(18)15(13-19(16)21-2)14-20-11-7-4-8-12-20/h9-10,13H,3-8,11-12,14H2,1-2H3 |
| InChIKey | FYEFALOAJKPFHF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine?
The IUPAC name of 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine (CID 170588431) is 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine.
What is the SMILES notation for 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine?
The canonical SMILES for 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine is CCc1c(OC)cc(CN2CCCCC2)c2c1=CCCC=2.
What is the InChIKey of 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine?
The InChIKey is FYEFALOAJKPFHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO/c1-3-16-18-10-6-5-9-17(18)15(13-19(16)21-2)14-20-11-7-4-8-12-20/h9-10,13H,3-8,11-12,14H2,1-2H3.
What are the key properties of 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine?
1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine has a molecular weight of 285.43 g/mol, XLogP of 2.60, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-ethyl-3-methoxy-6,7-dihydronaphthalen-1-yl)methyl]piperidine is sourced from PubChem (CID 170588431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).