C13H15F5N2 — CID 170588792
ethane;6-ethyl-5,7-difluoro-1-(2,2,2-trifluoroethyl)indazole (PubChem CID 170588792) has the molecular formula C13H15F5N2 and a molecular weight of 294.27 g/mol. Its IUPAC name is ethane;6-ethyl-5,7-difluoro-1-(2,2,2-trifluoroethyl)indazole.
| Compound Name | ethane;6-ethyl-5,7-difluoro-1-(2,2,2-trifluoroethyl)indazole |
|---|---|
| PubChem CID | 170588792 |
| Molecular Formula | C13H15F5N2 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | ethane;6-ethyl-5,7-difluoro-1-(2,2,2-trifluoroethyl)indazole |
| SMILES | CC.CCc1c(F)cc2cnn(CC(F)(F)F)c2c1F |
| InChI | InChI=1S/C11H9F5N2.C2H6/c1-2-7-8(12)3-6-4-17-18(5-11(14,15)16)10(6)9(7)13;1-2/h3-4H,2,5H2,1H3;1-2H3 |
| InChIKey | FUXJQCPEMXJEBA-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |