About ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione
ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione (PubChem CID 170589292) has the molecular formula C10H21N3OS
and a molecular weight of 231.36 g/mol. Its IUPAC name is ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione.
Molecular Properties
| Compound Name | ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione |
| PubChem CID | 170589292 |
| Molecular Formula | C10H21N3OS |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione |
| SMILES | CC.CNCC(C)=O.Cc1c[nH]c(=S)[nH]1 |
| InChI | InChI=1S/C4H6N2S.C4H9NO.C2H6/c1-3-2-5-4(7)6-3;1-4(6)3-5-2;1-2/h2H,1H3,(H2,5,6,7);5H,3H2,1-2H3;1-2H3 |
| InChIKey | GCYIYXYMSOQNCR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione?
The IUPAC name of ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione (CID 170589292) is ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione.
What is the SMILES notation for ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione?
The canonical SMILES for ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione is CC.CNCC(C)=O.Cc1c[nH]c(=S)[nH]1.
What is the InChIKey of ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione?
The InChIKey is GCYIYXYMSOQNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S.C4H9NO.C2H6/c1-3-2-5-4(7)6-3;1-4(6)3-5-2;1-2/h2H,1H3,(H2,5,6,7);5H,3H2,1-2H3;1-2H3.
What are the key properties of ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione?
ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione has a molecular weight of 231.36 g/mol, XLogP of 2.20, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(methylamino)propan-2-one;4-methyl-1,3-dihydroimidazole-2-thione is sourced from PubChem (CID 170589292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).