About 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene
1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene (PubChem CID 170590257) has the molecular formula C18H36O
and a molecular weight of 268.49 g/mol. Its IUPAC name is 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene.
Molecular Properties
| Compound Name | 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene |
| PubChem CID | 170590257 |
| Molecular Formula | C18H36O |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.28 |
| IUPAC Name | 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene |
| SMILES | C=CC.CCC.CCCC(=O)CC1CCCC(C)C1 |
| InChI | InChI=1S/C12H22O.C3H8.C3H6/c1-3-5-12(13)9-11-7-4-6-10(2)8-11;2*1-3-2/h10-11H,3-9H2,1-2H3;3H2,1-2H3;3H,1H2,2H3 |
| InChIKey | BUHZBXWUVHPWTF-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene?
The IUPAC name of 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene (CID 170590257) is 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene.
What is the SMILES notation for 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene?
The canonical SMILES for 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene is C=CC.CCC.CCCC(=O)CC1CCCC(C)C1.
What is the InChIKey of 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene?
The InChIKey is BUHZBXWUVHPWTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O.C3H8.C3H6/c1-3-5-12(13)9-11-7-4-6-10(2)8-11;2*1-3-2/h10-11H,3-9H2,1-2H3;3H2,1-2H3;3H,1H2,2H3.
What are the key properties of 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene?
1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene has a molecular weight of 268.49 g/mol, XLogP of 6.18, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylcyclohexyl)pentan-2-one;propane;prop-1-ene is sourced from PubChem (CID 170590257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).