C30H48N8O — CID 170590542
2-[N-[[1-[6-(3-aminopropylamino)pyrimidin-4-yl]-4-(methylamino)piperidin-4-yl]methyl]-4-[(4,4-dimethylpiperidin-1-yl)methyl]anilino]acetaldehyde (PubChem CID 170590542) has the molecular formula C30H48N8O and a molecular weight of 536.77 g/mol. Its IUPAC name is 2-[N-[[1-[6-(3-aminopropylamino)pyrimidin-4-yl]-4-(methylamino)piperidin-4-yl]methyl]-4-[(4,4-dimethylpiperidin-1-yl)methyl]anilino]acetaldehyde.
| Compound Name | 2-[N-[[1-[6-(3-aminopropylamino)pyrimidin-4-yl]-4-(methylamino)piperidin-4-yl]methyl]-4-[(4,4-dimethylpiperidin-1-yl)methyl]anilino]acetaldehyde |
|---|---|
| PubChem CID | 170590542 |
| Molecular Formula | C30H48N8O |
| Molecular Weight | 536.77 g/mol |
| Exact Mass | 536.40 |
| IUPAC Name | 2-[N-[[1-[6-(3-aminopropylamino)pyrimidin-4-yl]-4-(methylamino)piperidin-4-yl]methyl]-4-[(4,4-dimethylpiperidin-1-yl)methyl]anilino]acetaldehyde |
| SMILES | CNC1(CN(CC=O)c2ccc(CN3CCC(C)(C)CC3)cc2)CCN(c2cc(NCCCN)ncn2)CC1 |
| InChI | InChI=1S/C30H48N8O/c1-29(2)9-15-36(16-10-29)22-25-5-7-26(8-6-25)38(19-20-39)23-30(32-3)11-17-37(18-12-30)28-21-27(34-24-35-28)33-14-4-13-31/h5-8,20-21,24,32H,4,9-19,22-23,31H2,1-3H3,(H,33,34,35) |
| InChIKey | ZDQQZJAVBZIJMJ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 102.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.77 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|