C20H28 — CID 170590591
2-(2,4-dimethylidenecyclohexyl)-1,3,5-trimethyl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 170590591) has the molecular formula C20H28 and a molecular weight of 268.44 g/mol. Its IUPAC name is 2-(2,4-dimethylidenecyclohexyl)-1,3,5-trimethyl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 2-(2,4-dimethylidenecyclohexyl)-1,3,5-trimethyl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 170590591 |
| Molecular Formula | C20H28 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 2-(2,4-dimethylidenecyclohexyl)-1,3,5-trimethyl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | C=C1CCC(C2C(C)C3C=CC(C)=CC3C2C)C(=C)C1 |
| InChI | InChI=1S/C20H28/c1-12-6-8-17(14(3)10-12)20-15(4)18-9-7-13(2)11-19(18)16(20)5/h7,9,11,15-20H,1,3,6,8,10H2,2,4-5H3 |
| InChIKey | FDTZEKXZDNHASZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|