About 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane
4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane (PubChem CID 170590592) has the molecular formula C27H54
and a molecular weight of 378.73 g/mol. Its IUPAC name is 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane.
Molecular Properties
| Compound Name | 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane |
| PubChem CID | 170590592 |
| Molecular Formula | C27H54 |
| Molecular Weight | 378.73 g/mol |
| Exact Mass | 378.42 |
| IUPAC Name | 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane |
| SMILES | C=CCCc1ccc(CC)c(C)c1.CC.CC.CC.CCCC(C)(C)CC |
| InChI | InChI=1S/C13H18.C8H18.3C2H6/c1-4-6-7-12-8-9-13(5-2)11(3)10-12;1-5-7-8(3,4)6-2;3*1-2/h4,8-10H,1,5-7H2,2-3H3;5-7H2,1-4H3;3*1-2H3 |
| InChIKey | MRLOFTFKERCLDN-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.73 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane?
The IUPAC name of 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane (CID 170590592) is 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane.
What is the SMILES notation for 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane?
The canonical SMILES for 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane is C=CCCc1ccc(CC)c(C)c1.CC.CC.CC.CCCC(C)(C)CC.
What is the InChIKey of 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane?
The InChIKey is MRLOFTFKERCLDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18.C8H18.3C2H6/c1-4-6-7-12-8-9-13(5-2)11(3)10-12;1-5-7-8(3,4)6-2;3*1-2/h4,8-10H,1,5-7H2,2-3H3;5-7H2,1-4H3;3*1-2H3.
What are the key properties of 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane?
4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane has a molecular weight of 378.73 g/mol, XLogP of 9.98, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enyl-1-ethyl-2-methylbenzene;3,3-dimethylhexane;ethane is sourced from PubChem (CID 170590592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).