C15H19F3N6 — CID 170591919
(11S)-4,5,11-trimethyl-14-(trifluoromethyl)-2,6,7,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,5,13(17),14-pentaene (PubChem CID 170591919) has the molecular formula C15H19F3N6 and a molecular weight of 340.35 g/mol. Its IUPAC name is (11S)-4,5,11-trimethyl-14-(trifluoromethyl)-2,6,7,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,5,13(17),14-pentaene.
| Compound Name | (11S)-4,5,11-trimethyl-14-(trifluoromethyl)-2,6,7,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,5,13(17),14-pentaene |
|---|---|
| PubChem CID | 170591919 |
| Molecular Formula | C15H19F3N6 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (11S)-4,5,11-trimethyl-14-(trifluoromethyl)-2,6,7,12,16,17-hexazatricyclo[11.3.1.03,7]heptadeca-1(16),3,5,13(17),14-pentaene |
| SMILES | Cc1nn2c(c1C)Nc1ncc(C(F)(F)F)c(n1)N[C@@H](C)CCC2 |
| InChI | InChI=1S/C15H19F3N6/c1-8-5-4-6-24-13(9(2)10(3)23-24)22-14-19-7-11(15(16,17)18)12(20-8)21-14/h7-8H,4-6H2,1-3H3,(H2,19,20,21,22)/t8-/m0/s1 |
| InChIKey | KFMDHDJXWPOTAR-QMMMGPOBSA-N |
| XLogP | 3.65 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |