C35H52N4O4S — CID 170592127
N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)amino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-N'-(3-formyl-1-methoxypentan-3-yl)-N-methylbutanimidamide;ethane (PubChem CID 170592127) has the molecular formula C35H52N4O4S and a molecular weight of 624.89 g/mol. Its IUPAC name is N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)amino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-N'-(3-formyl-1-methoxypentan-3-yl)-N-methylbutanimidamide;ethane.
| Compound Name | N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)amino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-N'-(3-formyl-1-methoxypentan-3-yl)-N-methylbutanimidamide;ethane |
|---|---|
| PubChem CID | 170592127 |
| Molecular Formula | C35H52N4O4S |
| Molecular Weight | 624.89 g/mol |
| Exact Mass | 624.37 |
| IUPAC Name | N-[[4-[2-[(4,5-dimethyl-1,2-oxazol-3-yl)amino]sulfanylphenyl]-3-(ethoxymethyl)phenyl]methyl]-N'-(3-formyl-1-methoxypentan-3-yl)-N-methylbutanimidamide;ethane |
| SMILES | CC.CCC/C(=N\C(C=O)(CC)CCOC)N(C)Cc1ccc(-c2ccccc2SNc2noc(C)c2C)c(COCC)c1 |
| InChI | InChI=1S/C33H46N4O4S.C2H6/c1-8-13-31(34-33(9-2,23-38)18-19-39-7)37(6)21-26-16-17-28(27(20-26)22-40-10-3)29-14-11-12-15-30(29)42-36-32-24(4)25(5)41-35-32;1-2/h11-12,14-17,20,23H,8-10,13,18-19,21-22H2,1-7H3,(H,35,36);1-2H3/b34-31+; |
| InChIKey | ULPVHPPNGRZFLE-AJUJGTJDSA-N |
| XLogP | 8.65 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.89 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|