C18H28F5N3O2 — CID 170592248
N-[C-butyl-N-[4-methyl-1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]carbonimidoyl]-N-propan-2-ylformamide (PubChem CID 170592248) has the molecular formula C18H28F5N3O2 and a molecular weight of 413.43 g/mol. Its IUPAC name is N-[C-butyl-N-[4-methyl-1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]carbonimidoyl]-N-propan-2-ylformamide.
| Compound Name | N-[C-butyl-N-[4-methyl-1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]carbonimidoyl]-N-propan-2-ylformamide |
|---|---|
| PubChem CID | 170592248 |
| Molecular Formula | C18H28F5N3O2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | N-[C-butyl-N-[4-methyl-1-(2,2,3,3,3-pentafluoropropanoyl)piperidin-4-yl]carbonimidoyl]-N-propan-2-ylformamide |
| SMILES | CCCC/C(=N\C1(C)CCN(C(=O)C(F)(F)C(F)(F)F)CC1)N(C=O)C(C)C |
| InChI | InChI=1S/C18H28F5N3O2/c1-5-6-7-14(26(12-27)13(2)3)24-16(4)8-10-25(11-9-16)15(28)17(19,20)18(21,22)23/h12-13H,5-11H2,1-4H3/b24-14+ |
| InChIKey | POWMRZKUBMIKLD-ZVHZXABRSA-N |
| XLogP | 4.02 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|