About (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine
(5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine (PubChem CID 170592572) has the molecular formula C5H11N3
and a molecular weight of 113.16 g/mol. Its IUPAC name is (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine.
Molecular Properties
| Compound Name | (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine |
| PubChem CID | 170592572 |
| Molecular Formula | C5H11N3 |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.10 |
| IUPAC Name | (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine |
| SMILES | C[C@@H]1CN=C(N)N1C |
| InChI | InChI=1S/C5H11N3/c1-4-3-7-5(6)8(4)2/h4H,3H2,1-2H3,(H2,6,7)/t4-/m1/s1 |
| InChIKey | DOEITEXCMVAQDF-SCSAIBSYSA-N |
| XLogP | -0.37 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine?
The IUPAC name of (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine (CID 170592572) is (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine.
What is the SMILES notation for (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine?
The canonical SMILES for (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine is C[C@@H]1CN=C(N)N1C.
What is the InChIKey of (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine?
The InChIKey is DOEITEXCMVAQDF-SCSAIBSYSA-N. The full InChI is InChI=1S/C5H11N3/c1-4-3-7-5(6)8(4)2/h4H,3H2,1-2H3,(H2,6,7)/t4-/m1/s1.
What are the key properties of (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine?
(5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine has a molecular weight of 113.16 g/mol, XLogP of -0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-1,5-dimethyl-4,5-dihydroimidazol-2-amine is sourced from PubChem (CID 170592572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).