C13H15N3O3S — CID 170592591
(1R)-1-ethyl-4-methyl-5-oxo-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinic acid (PubChem CID 170592591) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is (1R)-1-ethyl-4-methyl-5-oxo-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinic acid.
| Compound Name | (1R)-1-ethyl-4-methyl-5-oxo-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinic acid |
|---|---|
| PubChem CID | 170592591 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | (1R)-1-ethyl-4-methyl-5-oxo-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinic acid |
| SMILES | CC[C@@H]1CN=C2N(C)C(=O)c3cc(S(=O)O)ccc3N21 |
| InChI | InChI=1S/C13H15N3O3S/c1-3-8-7-14-13-15(2)12(17)10-6-9(20(18)19)4-5-11(10)16(8)13/h4-6,8H,3,7H2,1-2H3,(H,18,19)/t8-/m1/s1 |
| InChIKey | GSZSHPYUEKFQIC-MRVPVSSYSA-N |
| XLogP | 1.31 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|