About (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine
(Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine (PubChem CID 170592620) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine.
Molecular Properties
| Compound Name | (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine |
| PubChem CID | 170592620 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine |
| SMILES | CC/C(=C/N)C1=NCCCO1 |
| InChI | InChI=1S/C8H14N2O/c1-2-7(6-9)8-10-4-3-5-11-8/h6H,2-5,9H2,1H3/b7-6- |
| InChIKey | KLLBYKXKFKWODM-SREVYHEPSA-N |
| XLogP | 1.06 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine?
The IUPAC name of (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine (CID 170592620) is (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine.
What is the SMILES notation for (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine?
The canonical SMILES for (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine is CC/C(=C/N)C1=NCCCO1.
What is the InChIKey of (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine?
The InChIKey is KLLBYKXKFKWODM-SREVYHEPSA-N. The full InChI is InChI=1S/C8H14N2O/c1-2-7(6-9)8-10-4-3-5-11-8/h6H,2-5,9H2,1H3/b7-6-.
What are the key properties of (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine?
(Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine has a molecular weight of 154.21 g/mol, XLogP of 1.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(5,6-dihydro-4H-1,3-oxazin-2-yl)but-1-en-1-amine is sourced from PubChem (CID 170592620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).