C15H20N3O3S- — CID 170592643
ethane;(1S)-1-ethyl-4-methyl-5-oxo-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinate (PubChem CID 170592643) has the molecular formula C15H20N3O3S- and a molecular weight of 322.41 g/mol. Its IUPAC name is ethane;(1S)-1-ethyl-4-methyl-5-oxo-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinate.
| Compound Name | ethane;(1S)-1-ethyl-4-methyl-5-oxo-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinate |
|---|---|
| PubChem CID | 170592643 |
| Molecular Formula | C15H20N3O3S- |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | ethane;(1S)-1-ethyl-4-methyl-5-oxo-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinate |
| SMILES | CC.CC[C@H]1CN=C2N(C)C(=O)c3cc(S(=O)[O-])ccc3N21 |
| InChI | InChI=1S/C13H15N3O3S.C2H6/c1-3-8-7-14-13-15(2)12(17)10-6-9(20(18)19)4-5-11(10)16(8)13;1-2/h4-6,8H,3,7H2,1-2H3,(H,18,19);1-2H3/p-1/t8-;/m0./s1 |
| InChIKey | OOCPRFASXAGBFM-QRPNPIFTSA-M |
| XLogP | 1.99 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|