C14H17N3O3S — CID 170592673
4-methyl-5-oxo-1-propan-2-yl-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinic acid (PubChem CID 170592673) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is 4-methyl-5-oxo-1-propan-2-yl-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinic acid.
| Compound Name | 4-methyl-5-oxo-1-propan-2-yl-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinic acid |
|---|---|
| PubChem CID | 170592673 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 4-methyl-5-oxo-1-propan-2-yl-1,2-dihydroimidazo[1,2-a]quinazoline-7-sulfinic acid |
| SMILES | CC(C)C1CN=C2N(C)C(=O)c3cc(S(=O)O)ccc3N21 |
| InChI | InChI=1S/C14H17N3O3S/c1-8(2)12-7-15-14-16(3)13(18)10-6-9(21(19)20)4-5-11(10)17(12)14/h4-6,8,12H,7H2,1-3H3,(H,19,20) |
| InChIKey | CWGCOAIDHDKJBT-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|