C14H19F2N3O2 — CID 170592963
ethane;methyl N-[[2-(3,4-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate (PubChem CID 170592963) has the molecular formula C14H19F2N3O2 and a molecular weight of 299.32 g/mol. Its IUPAC name is ethane;methyl N-[[2-(3,4-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate.
| Compound Name | ethane;methyl N-[[2-(3,4-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate |
|---|---|
| PubChem CID | 170592963 |
| Molecular Formula | C14H19F2N3O2 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | ethane;methyl N-[[2-(3,4-difluorophenyl)-3,4-dihydro-2H-pyrrol-5-yl]amino]carbamate |
| SMILES | CC.COC(=O)NNC1=NC(c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C12H13F2N3O2.C2H6/c1-19-12(18)17-16-11-5-4-10(15-11)7-2-3-8(13)9(14)6-7;1-2/h2-3,6,10H,4-5H2,1H3,(H,15,16)(H,17,18);1-2H3 |
| InChIKey | CXSLAGHXPLNNBX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|