C22H18FN3O2S — CID 170593257
(6-aminosulfanyl-5-fluoro-2,3-dihydroindol-1-yl)-(6-pyridin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methanone (PubChem CID 170593257) has the molecular formula C22H18FN3O2S and a molecular weight of 407.47 g/mol. Its IUPAC name is (6-aminosulfanyl-5-fluoro-2,3-dihydroindol-1-yl)-(6-pyridin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methanone.
| Compound Name | (6-aminosulfanyl-5-fluoro-2,3-dihydroindol-1-yl)-(6-pyridin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 170593257 |
| Molecular Formula | C22H18FN3O2S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | (6-aminosulfanyl-5-fluoro-2,3-dihydroindol-1-yl)-(6-pyridin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methanone |
| SMILES | NSc1cc2c(cc1F)CCN2C(=O)C1Cc2ccc(-c3ccccn3)cc2O1 |
| InChI | InChI=1S/C22H18FN3O2S/c23-16-9-14-6-8-26(18(14)12-21(16)29-24)22(27)20-11-15-5-4-13(10-19(15)28-20)17-3-1-2-7-25-17/h1-5,7,9-10,12,20H,6,8,11,24H2 |
| InChIKey | YPOSNSPUUJMGBX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|