About CID 170593320
CID 170593320 (PubChem CID 170593320) has the molecular formula C11H18BN
and a molecular weight of 175.08 g/mol.
Molecular Properties
| Compound Name | CID 170593320 |
| PubChem CID | 170593320 |
| Molecular Formula | C11H18BN |
| Molecular Weight | 175.08 g/mol |
| Exact Mass | 175.15 |
| IUPAC Name | — |
| SMILES | CC.[B]c1cc(C)c2c(c1)NCC2.[H][H] |
| InChI | InChI=1S/C9H10BN.C2H6.H2/c1-6-4-7(10)5-9-8(6)2-3-11-9;1-2;/h4-5,11H,2-3H2,1H3;1-2H3;1H |
| InChIKey | DDTJJRLVLRNGNU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.08 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 170593320 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170593320?
The IUPAC name of CID 170593320 (CID 170593320) is not available.
What is the SMILES notation for CID 170593320?
The canonical SMILES for CID 170593320 is CC.[B]c1cc(C)c2c(c1)NCC2.[H][H].
What is the InChIKey of CID 170593320?
The InChIKey is DDTJJRLVLRNGNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BN.C2H6.H2/c1-6-4-7(10)5-9-8(6)2-3-11-9;1-2;/h4-5,11H,2-3H2,1H3;1-2H3;1H.
What are the key properties of CID 170593320?
CID 170593320 has a molecular weight of 175.08 g/mol, XLogP of 2.03, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170593320 is sourced from PubChem (CID 170593320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).