C23H22FN3OS — CID 170593330
6-aminosulfanyl-2,3-dihydroindole-1-carbaldehyde;2-(2,3-dihydro-1H-inden-5-yl)-3-fluoropyridine (PubChem CID 170593330) has the molecular formula C23H22FN3OS and a molecular weight of 407.51 g/mol. Its IUPAC name is 6-aminosulfanyl-2,3-dihydroindole-1-carbaldehyde;2-(2,3-dihydro-1H-inden-5-yl)-3-fluoropyridine.
| Compound Name | 6-aminosulfanyl-2,3-dihydroindole-1-carbaldehyde;2-(2,3-dihydro-1H-inden-5-yl)-3-fluoropyridine |
|---|---|
| PubChem CID | 170593330 |
| Molecular Formula | C23H22FN3OS |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 6-aminosulfanyl-2,3-dihydroindole-1-carbaldehyde;2-(2,3-dihydro-1H-inden-5-yl)-3-fluoropyridine |
| SMILES | Fc1cccnc1-c1ccc2c(c1)CCC2.NSc1ccc2c(c1)N(C=O)CC2 |
| InChI | InChI=1S/C14H12FN.C9H10N2OS/c15-13-5-2-8-16-14(13)12-7-6-10-3-1-4-11(10)9-12;10-13-8-2-1-7-3-4-11(6-12)9(7)5-8/h2,5-9H,1,3-4H2;1-2,5-6H,3-4,10H2 |
| InChIKey | CGXPVCUDRZRYPM-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|