C23H20FN3O2S — CID 170593342
(6-aminosulfanyl-5-fluoro-2-methyl-2,3-dihydroindol-1-yl)-(5-pyridin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methanone (PubChem CID 170593342) has the molecular formula C23H20FN3O2S and a molecular weight of 421.50 g/mol. Its IUPAC name is (6-aminosulfanyl-5-fluoro-2-methyl-2,3-dihydroindol-1-yl)-(5-pyridin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methanone.
| Compound Name | (6-aminosulfanyl-5-fluoro-2-methyl-2,3-dihydroindol-1-yl)-(5-pyridin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methanone |
|---|---|
| PubChem CID | 170593342 |
| Molecular Formula | C23H20FN3O2S |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (6-aminosulfanyl-5-fluoro-2-methyl-2,3-dihydroindol-1-yl)-(5-pyridin-2-yl-2,3-dihydro-1-benzofuran-2-yl)methanone |
| SMILES | CC1Cc2cc(F)c(SN)cc2N1C(=O)C1Cc2cc(-c3ccccn3)ccc2O1 |
| InChI | InChI=1S/C23H20FN3O2S/c1-13-8-15-10-17(24)22(30-25)12-19(15)27(13)23(28)21-11-16-9-14(5-6-20(16)29-21)18-4-2-3-7-26-18/h2-7,9-10,12-13,21H,8,11,25H2,1H3 |
| InChIKey | QRRSSGNUOFHZKV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|