C16H13FN6O — CID 170593703
N-[6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroimidazo[1,2-a]pyridin-2-yl]formamide (PubChem CID 170593703) has the molecular formula C16H13FN6O and a molecular weight of 324.32 g/mol. Its IUPAC name is N-[6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroimidazo[1,2-a]pyridin-2-yl]formamide.
| Compound Name | N-[6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroimidazo[1,2-a]pyridin-2-yl]formamide |
|---|---|
| PubChem CID | 170593703 |
| Molecular Formula | C16H13FN6O |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-[6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-8-fluoroimidazo[1,2-a]pyridin-2-yl]formamide |
| SMILES | Cc1cn2nc(-c3cc(F)c4nc(NC=O)cn4c3)cc(C)c2n1 |
| InChI | InChI=1S/C16H13FN6O/c1-9-3-13(21-23-5-10(2)19-15(9)23)11-4-12(17)16-20-14(18-8-24)7-22(16)6-11/h3-8H,1-2H3,(H,18,24) |
| InChIKey | ZRRGQASFTOHLIS-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|