C21H21ClF6N6O — CID 170594240
N'-[7-[3-amino-2-chloro-4,5-difluoro-6-(trifluoromethyl)phenyl]-8-fluoro-2-methoxy-5-propylpyrido[4,3-d]pyrimidin-4-yl]-N-methylethane-1,2-diamine (PubChem CID 170594240) has the molecular formula C21H21ClF6N6O and a molecular weight of 522.88 g/mol. Its IUPAC name is N'-[7-[3-amino-2-chloro-4,5-difluoro-6-(trifluoromethyl)phenyl]-8-fluoro-2-methoxy-5-propylpyrido[4,3-d]pyrimidin-4-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[7-[3-amino-2-chloro-4,5-difluoro-6-(trifluoromethyl)phenyl]-8-fluoro-2-methoxy-5-propylpyrido[4,3-d]pyrimidin-4-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 170594240 |
| Molecular Formula | C21H21ClF6N6O |
| Molecular Weight | 522.88 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | N'-[7-[3-amino-2-chloro-4,5-difluoro-6-(trifluoromethyl)phenyl]-8-fluoro-2-methoxy-5-propylpyrido[4,3-d]pyrimidin-4-yl]-N-methylethane-1,2-diamine |
| SMILES | CCCc1nc(-c2c(Cl)c(N)c(F)c(F)c2C(F)(F)F)c(F)c2nc(OC)nc(NCCNC)c12 |
| InChI | InChI=1S/C21H21ClF6N6O/c1-4-5-8-9-17(33-20(35-3)34-19(9)31-7-6-30-2)15(25)18(32-8)10-11(21(26,27)28)13(23)14(24)16(29)12(10)22/h30H,4-7,29H2,1-3H3,(H,31,33,34) |
| InChIKey | YYWPNIJCTCZBSV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|